CAS 97561-96-1

5-(2-fluorobenzyl)-3,3-dimethylpyrrolidin-2-one

Description:

5-(2-Fluorobenzyl)-3,3-dimethylpyrrolidin-2-one is a chemical compound characterized by its unique structure, which includes a pyrrolidinone ring substituted with a 2-fluorobenzyl group and two methyl groups at the 3-position. This compound typically exhibits properties associated with both amides and cyclic ketones, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of the fluorobenzyl group may impart specific electronic and steric effects, influencing its reactivity and interactions with biological targets. As a pyrrolidinone derivative, it may also exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular weight, boiling point, melting point, and specific reactivity would depend on its precise structural configuration and the conditions under which it is studied. Safety data, including toxicity and handling precautions, should be consulted from reliable sources when working with this substance. Overall, 5-(2-fluorobenzyl)-3,3-dimethylpyrrolidin-2-one represents a noteworthy example of a functionalized heterocyclic compound with potential applications in various fields.

Formula: C₁₃H₁₆FNO

InChI: InChI=1/C13H16FNO/c1-13(2)8-10(15-12(13)16)7-9-5-3-4-6-11(9)14/h3-6,10H,7-8H2,1-2H3,(H,15,16)

SMILES: CC1(C)CC(Cc2ccccc2F)N=C1O