CAS 97576-09-5
:4-(4-methoxybenzoyl)phenyl acetate
Description:
4-(4-Methoxybenzoyl)phenyl acetate, with the CAS number 97576-09-5, is an organic compound characterized by its aromatic structure and functional groups. It features a phenyl acetate moiety linked to a 4-methoxybenzoyl group, which contributes to its chemical properties. This compound typically exhibits a moderate to high melting point and is likely to be soluble in organic solvents such as ethanol and acetone, while being less soluble in water due to its hydrophobic aromatic components. The presence of the methoxy group enhances its electron-donating ability, potentially influencing its reactivity and interactions in various chemical environments. Additionally, this compound may exhibit biological activity, making it of interest in fields such as pharmaceuticals or materials science. Its synthesis often involves acylation reactions, and it may be used as an intermediate in the production of more complex organic molecules. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C16H14O4
InChI:InChI=1/C16H14O4/c1-11(17)20-15-9-5-13(6-10-15)16(18)12-3-7-14(19-2)8-4-12/h3-10H,1-2H3
SMILES:CC(=O)Oc1ccc(cc1)C(=O)c1ccc(cc1)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.