
CAS 97592-73-9
:Formaldehyde, reaction products with 29-(C12-18-alkylamino)-3,6,9,12,15,18,21,24,27-nonaoxanonacosan-1-ol
Description:
Formaldehyde, reaction products with 29-(C12-18-alkylamino)-3,6,9,12,15,18,21,24,27-nonaoxanonacosan-1-ol, is a complex chemical substance primarily used in various industrial applications, including as a surfactant and emulsifier. This compound features a long-chain alkyl structure, which contributes to its amphiphilic properties, allowing it to interact with both hydrophilic and hydrophobic environments. The presence of multiple ether linkages in its structure enhances its solubility in water and organic solvents, making it versatile in formulations. Additionally, the alkylamino groups provide potential for interaction with biological systems, which may influence its behavior in applications such as personal care products or agricultural formulations. Safety considerations are important, as formaldehyde is known to be a sensitizer and potential irritant. Therefore, handling and usage guidelines must be followed to mitigate any health risks. Overall, this substance exemplifies the characteristics of a surfactant with a unique structure that can be tailored for specific applications in various industries.
Formula:C20H43NO10·CH2O
InChI:InChI=1S/C20H43NO10.CH2O/c21-1-3-23-5-7-25-9-11-27-13-15-29-17-19-31-20-18-30-16-14-28-12-10-26-8-6-24-4-2-22;1-2/h22H,1-21H2;1H2
InChI key:InChIKey=OGDGOSBBDBZREH-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOCCOCCN)CCOCCOCCOCCOCCO.C=O
Synonyms:- Formaldehyde, reaction products with 29-(C12-18-alkylamino)-3,6,9,12,15,18,21,24,27-nonaoxanonacosan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Formaldehyde, reaction products with 29-(C12-18-alkylamino)-3,6,9,12,15,18,21,24,27-nonaoxanonacosan-1-ol
CAS:Formula:C21H45NO11Molecular weight:487.5821
