CAS 97600-45-8
:hexaethyl 2,2',2'',2''',2'''',2'''''-[heptacyclo[31.3.1.1~3,7~.1~9,13~.1~15,19~.1~21,25~.1~27,31~]dotetraconta-1(37),3(42),4,6,9(41),10,12,15(40),16,18,21(39),22,24,27(38),28,30,33,35-octadecaene-37,38,39,40,41,42-hexaylhexakis(oxy)]hexaacetate
Description:
Hexaethyl 2,2',2'',2''',2'''',2'''''-[heptacyclo[31.3.1.1~3,7~.1~9,13~.1~15,19~.1~21,25~.1~27,31~]dotetraconta-1(37),3(42),4,6,9(41),10,12,15(40),16,18,21(39),22,24,27(38),28,30,33,35-octadecaene-37,38,39,40,41,42-hexaylhexakis(oxy)]hexaacetate is a complex organic compound characterized by its extensive polycyclic structure and multiple functional groups. This substance features a heptacyclic framework, which contributes to its unique chemical properties, including potential rigidity and stability. The presence of multiple ethyl and acetate groups enhances its solubility in organic solvents and may influence its reactivity. The compound's intricate structure suggests potential applications in materials science, particularly in the development of advanced polymers or nanomaterials. However, due to its complexity, detailed studies on its physical and chemical properties, such as melting point, boiling point, and reactivity, would be necessary to fully understand its behavior in various environments. Safety data and handling precautions should also be considered, given the potential hazards associated with large organic molecules.
Formula:C66H72O18
InChI:InChI=1/C66H72O18/c1-7-73-55(67)37-79-61-43-19-13-20-44(61)32-46-22-15-24-48(63(46)81-39-57(69)75-9-3)34-50-26-17-28-52(65(50)83-41-59(71)77-11-5)36-54-30-18-29-53(66(54)84-42-60(72)78-12-6)35-51-27-16-25-49(64(51)82-40-58(70)76-10-4)33-47-23-14-21-45(31-43)62(47)80-38-56(68)74-8-2/h13-30H,7-12,31-42H2,1-6H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.