CAS 97614-41-0

1,3,5-tris-O-(phenylcarbonyl)-2-O-[(trifluoromethyl)sulfonyl]pentofuranose

Description:

1,3,5-Tris-O-(phenylcarbonyl)-2-O-[(trifluoromethyl)sulfonyl]pentofuranose is a complex organic compound characterized by its unique structural features and functional groups. This substance contains a pentofuranose sugar backbone, which is a five-membered ring structure that includes oxygen. The presence of three phenylcarbonyl groups indicates that the compound has multiple aromatic carbonyl functionalities, contributing to its potential reactivity and solubility properties. Additionally, the incorporation of a trifluoromethylsulfonyl group enhances its electrophilic character, making it useful in various chemical reactions, particularly in synthetic organic chemistry. The trifluoromethyl group is known for imparting unique electronic properties, which can influence the compound's behavior in biological systems or as a reagent. Overall, this compound's intricate structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis, although specific applications would depend on further research and exploration of its chemical properties and reactivity.

Formula: C₂₇H₂₁F₃O₁₀S

InChI: InChI=1/C27H21F3O10S/c28-27(29,30)41(34,35)40-22-21(38-24(32)18-12-6-2-7-13-18)20(16-36-23(31)17-10-4-1-5-11-17)37-26(22)39-25(33)19-14-8-3-9-15-19/h1-15,20-22,26H,16H2

SMILES: c1ccc(cc1)C(=O)OCC1C(C(C(O1)OC(=O)c1ccccc1)OS(=O)(=O)C(F)(F)F)OC(=O)c1ccccc1

1,3,5-Tri-O-benzoyl-2-O-(trifluoromethanesulfonyl)-a-D-ribofuranose

CAS: 97614-41-0

Formula: C₂₇H₂₁F₃O₁₀S

Purity: ≥ 95.0%

Color and Shape: Yellow oil

Molecular weight: 594.51

Ref: 7W-GC5018

1,3,5-Tri-O-benzoyl-2-O-(trifluoromethanesulfonyl)-a-D-ribofuranose

CAS: 97614-41-0

1,3,5-Tri-O-benzoyl-2-O-(trifluoromethanesulfonyl)-a-D-ribofuranose is a nucleoside that is phosphorylated by the enzyme deoxycytidine kinase to form 1,3,5-tri-O-benzoyl-2'-O-(trifluoromethanesulfonyl)-a-[D]ribofuranosyl phosphate. This compound has been shown to activate immune cells in vitro and in vivo. The activation of immune cells may be due to its ability to inhibit the expression of enzymes that are required for DNA synthesis. 1,3,5-Tri-O-benzoyl-2'-O-(trifluoromethanesulfonyl)-a-[D]ribofuranosyl phosphate also inhibits the expression of enzymes involved in DNA replication and cell proliferation.

Formula: C₂₇H₂₁F₃O₁₀S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 594.51 g/mol

Ref: 3D-MT07900