CAS 97614-45-4
:1-(3,5-Di-O-benzoyl-2-deoxy-2-fluoro-β-D-arabinofuranosyl)-5-iodo-2,4(1H,3H)-pyrimidinedione
Description:
1-(3,5-Di-O-benzoyl-2-deoxy-2-fluoro-β-D-arabinofuranosyl)-5-iodo-2,4(1H,3H)-pyrimidinedione is a complex organic compound characterized by its unique structural features, which include a pyrimidinedione core and a modified sugar moiety. The presence of the 2-deoxy-2-fluoro-β-D-arabinofuranosyl group suggests that it may exhibit biological activity, potentially as an antiviral or anticancer agent, due to the fluorine substitution which can enhance metabolic stability. The di-O-benzoyl groups indicate that the compound is likely to be lipophilic, which may influence its solubility and permeability in biological systems. The iodine atom in the pyrimidinedione structure can also impart unique reactivity and may be involved in various chemical transformations. Overall, this compound's intricate structure and functional groups suggest potential applications in medicinal chemistry, particularly in the development of nucleoside analogs. However, detailed studies would be necessary to fully elucidate its properties and biological effects.
Formula:C23H18FIN2O7
InChI:InChI=1S/C23H18FIN2O7/c24-17-18(34-22(30)14-9-5-2-6-10-14)16(12-32-21(29)13-7-3-1-4-8-13)33-20(17)27-11-15(25)19(28)26-23(27)31/h1-11,16-18,20H,12H2,(H,26,28,31)/t16-,17+,18-,20-/m1/s1
InChI key:InChIKey=FBENGCVQLDKVAT-AJYBTWMASA-N
SMILES:F[C@@H]1[C@@H](O[C@H](COC(=O)C2=CC=CC=C2)[C@H]1OC(=O)C3=CC=CC=C3)N4C(=O)NC(=O)C(I)=C4
Synonyms:- 1-(3,5-Di-O-benzoyl-2-deoxy-2-fluoro-β-D-arabinofuranosyl)-5-iodo-2,4(1H,3H)-pyrimidinedione
- 2,4(1H,3H)-Pyrimidinedione, 1-(3,5-di-O-benzoyl-2-deoxy-2-fluoro-β-D-arabinofuranosyl)-5-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3',5'-Di-O-benzoyl fialuridine
CAS:Nucleoside, fluoro-modified nucleoside, halo-nucleoside; Arabino-nucleosideFormula:C23H18FIN2O7Color and Shape:SolidMolecular weight:580.3Ref: TM-TNU0637
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire
