CAS 97620-82-1
:3-hydroxybenzo[b]naphtho[2,3-d]furan-6,11-dione
Description:
3-Hydroxybenzo[b]naphtho[2,3-d]furan-6,11-dione, with the CAS number 97620-82-1, is a polycyclic aromatic compound characterized by its complex fused ring structure, which includes both naphthalene and furan moieties. This compound features a hydroxyl group (-OH) and two carbonyl groups (C=O) that contribute to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit a range of colors depending on its purity and specific structural conformation. The presence of the hydroxyl group suggests potential for hydrogen bonding, which can influence its solubility in various solvents. Additionally, the compound may exhibit interesting electronic properties due to its conjugated system, making it a candidate for studies in organic electronics or as a dye. Its unique structure may also confer specific pharmacological properties, warranting investigation in medicinal chemistry. However, detailed studies on its toxicity, stability, and reactivity are essential for understanding its practical applications and safety profile.
Formula:C16H8O4
InChI:InChI=1/C16H8O4/c17-8-5-6-11-12(7-8)20-16-13(11)14(18)9-3-1-2-4-10(9)15(16)19/h1-7,17H
Synonyms:- benzo[b]naphtho[2,3-d]furan-6,11-dione, 3-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.