CAS 97630-12-1

1-{[3,5-bis(trifluoromethyl)phenyl]sulfonyl}piperazine hydrochloride

Description:

1-{[3,5-bis(trifluoromethyl)phenyl]sulfonyl}piperazine hydrochloride is a chemical compound characterized by its complex structure, which includes a piperazine ring and a sulfonyl group attached to a phenyl moiety that is heavily substituted with trifluoromethyl groups. This compound typically appears as a white to off-white solid and is soluble in polar solvents, reflecting its ionic nature due to the hydrochloride form. The presence of trifluoromethyl groups contributes to its lipophilicity and can enhance biological activity, making it of interest in pharmaceutical research. The sulfonyl group often plays a crucial role in the compound's reactivity and potential interactions with biological targets. As a hydrochloride salt, it is generally more stable and easier to handle than its free base form. This compound may exhibit various pharmacological properties, which are often explored in the context of drug development, particularly in areas such as neuropharmacology or as a potential therapeutic agent. Safety and handling precautions should be observed due to the presence of fluorinated groups, which can pose environmental and health risks.

Formula: C₁₂H₁₃ClF₆N₂O₂S

InChI: InChI=1/C12H12F6N2O2S.ClH/c13-11(14,15)8-5-9(12(16,17)18)7-10(6-8)23(21,22)20-3-1-19-2-4-20;/h5-7,19H,1-4H2;1H

SMILES: C1CN(CCN1)S(=O)(=O)c1cc(cc(c1)C(F)(F)F)C(F)(F)F.Cl