CAS 97630-13-2

Piperazine, 1-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl]-

Description:

Piperazine, 1-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl]- is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. This compound features a sulfonyl group attached to a phenyl ring that is further substituted with a chloro group and a trifluoromethyl group, contributing to its unique chemical properties. The presence of the trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, making it of interest in pharmaceutical research. The sulfonyl moiety often plays a crucial role in the reactivity and interaction of the compound with biological targets. Piperazine derivatives are known for their diverse applications, including use as intermediates in drug synthesis and as potential therapeutic agents. The compound's molecular structure suggests it may exhibit specific pharmacological properties, although detailed studies would be necessary to elucidate its full biological profile. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and environmental impact.

Formula: C₁₁H₁₂ClF₃N₂O₂S

InChI: InChI=1S/C11H12ClF3N2O2S/c12-10-2-1-8(7-9(10)11(13,14)15)20(18,19)17-5-3-16-4-6-17/h1-2,7,16H,3-6H2

InChI key: InChIKey=RXZYZWZTSFNUHI-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC(C(F)(F)F)=C(Cl)C=C1)N2CCNCC2

Synonyms:

• 1-([4-Chloro-3-(trifluoromethyl)phenyl]sulfonyl)piperazine
• 1-[4-Chloro-3-(trifluoromethyl)benzenesulfonyl]piperazine
• Piperazine, 1-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl]-

1-[4-Chloro-3-(trifluoromethyl)benzenesulfonyl]piperazine

CAS: 97630-13-2

Versatile small molecule scaffold

Formula: C₁₁H₁₂ClF₃N₂O₂S

Purity: Min. 95%

Molecular weight: 328.74 g/mol

Ref: 3D-XDA63013