CymitQuimica logo

CAS 97632-67-2

:

7-methoxy-2-oxo-2H-chromene-3-carbonyl azide

Description:
7-Methoxy-2-oxo-2H-chromene-3-carbonyl azide, with the CAS number 97632-67-2, is a chemical compound that belongs to the class of chromenes, which are characterized by a benzopyran structure. This compound features a methoxy group at the 7-position and an azide functional group, which is known for its reactivity and potential applications in organic synthesis and materials science. The presence of the carbonyl group enhances its electrophilic character, making it suitable for various chemical reactions, including cycloadditions and nucleophilic substitutions. The azide group can also serve as a precursor for the generation of nitrogen gas, which is useful in click chemistry. Overall, this compound exhibits unique properties that may be exploited in the development of pharmaceuticals, agrochemicals, or novel materials, although specific applications would depend on further research into its reactivity and stability under various conditions.
Formula:C11H7N3O4
InChI:InChI=1/C11H7N3O4/c1-17-7-3-2-6-4-8(10(15)13-14-12)11(16)18-9(6)5-7/h2-5H,1H3
SMILES:COc1ccc2cc(C(=O)N=[N+]=[NH-])c(=O)oc2c1
Synonyms:
  • 2H-1-benzopyran-3-carbonyl azide, 7-methoxy-2-oxo-
  • 7-Methoxycoumarin-3-Carbonyl Azide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.