
CAS 97640-51-2
:2-Bromo-4-methoxybenzenemethanamine
Description:
2-Bromo-4-methoxybenzenemethanamine, with the CAS number 97640-51-2, is an organic compound characterized by its aromatic structure, which includes a bromine atom and a methoxy group attached to a benzene ring. This compound features an amine functional group, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the bromine atom enhances its electrophilic properties, making it a useful intermediate in various chemical reactions, such as nucleophilic substitutions. The methoxy group can influence the compound's solubility and polarity, affecting its behavior in different solvents. Additionally, the amine group can participate in hydrogen bonding, impacting its physical properties, such as boiling and melting points. Overall, 2-Bromo-4-methoxybenzenemethanamine is a versatile compound with potential applications in pharmaceuticals and materials science, although specific properties like melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise information.
Formula:C8H10BrNO
InChI:InChI=1S/C8H10BrNO/c1-11-7-3-2-6(5-10)8(9)4-7/h2-4H,5,10H2,1H3
InChI key:InChIKey=KNPWNLAHPISBBC-UHFFFAOYSA-N
SMILES:O(C)C1=CC(Br)=C(CN)C=C1
Synonyms:- Benzenemethanamine, 2-bromo-4-methoxy-
- 2-Bromo-4-methoxybenzylamine
- (2-Bromo-4-methoxyphenyl)methanamine
- 2-Bromo-4-methoxybenzenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.