CAS 97702-82-4
:Iosarcol
Description:
Iosarcol, with the CAS number 97702-82-4, is a chemical compound that belongs to the class of substances known as antineoplastic agents, specifically used in cancer treatment. It is characterized by its ability to inhibit cell proliferation and induce apoptosis in cancer cells, making it a potential therapeutic agent in oncology. The compound exhibits a specific mechanism of action that may involve interference with DNA synthesis or repair processes, contributing to its efficacy against various tumor types. Iosarcol is typically administered under strict medical supervision due to its potent biological activity and potential side effects, which can include toxicity to normal cells. Its pharmacokinetics, including absorption, distribution, metabolism, and excretion, are critical for determining appropriate dosing regimens. As with many antineoplastic agents, ongoing research is essential to fully understand its therapeutic potential, optimal use, and long-term effects in patients.
Formula:C21H29I3N4O9
InChI:InChI=1/C21H29I3N4O9/c1-8(30)25-17-14(22)13(15(23)18(16(17)24)26-9(2)31)21(37)28(4)6-12(34)27(3)5-10(32)19(35)20(36)11(33)7-29/h10-11,19-20,29,32-33,35-36H,5-7H2,1-4H3,(H,25,30)(H,26,31)/t10-,11+,19+,20+/m0/s1
Synonyms:- Iosarcol [INN]
- 3,5-Diacetamido-2,4,6-triiodo-N-methyl-N((methyl(D-gluco-2,3,4,5,6-pentahydroxyhexyl)carbamoyl)methyl)benzamide
- Iosarcolum
- Iosarcolum [INN-Latin]
- Unii-4Dsd895Ogc
- 1-[{N-[3,5-bis(acetylamino)-2,4,6-triiodobenzoyl]-N-methylglycyl}(methyl)amino]-1-deoxyhexitol
- 1-[{N-[3,5-bis(acetylamino)-2,4,6-triiodobenzoyl]-N-methylglycyl}(methyl)amino]-1-deoxy-D-glucitol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
