CAS 97741-74-7
:7-bromo-2,3-dichlorooxanthrene
Description:
7-Bromo-2,3-dichlorooxanthrene is an organic compound characterized by its complex aromatic structure, which includes a fused ring system typical of oxanthrenes. The presence of bromine and chlorine substituents indicates that it is a halogenated compound, which can influence its reactivity, stability, and potential applications in various fields, including materials science and organic synthesis. The specific arrangement of the bromine and chlorine atoms can affect the compound's electronic properties, making it of interest in studies related to photochemistry and fluorescence. Additionally, halogenated compounds often exhibit unique solubility characteristics and can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The compound's CAS number, 97741-74-7, allows for precise identification and retrieval of information in chemical databases. Overall, 7-bromo-2,3-dichlorooxanthrene represents a specialized compound with potential utility in research and industrial applications, particularly in the development of new materials or as intermediates in organic synthesis.
Formula:C12H5BrCl2O2
InChI:InChI=1/C12H5BrCl2O2/c13-6-1-2-9-10(3-6)17-12-5-8(15)7(14)4-11(12)16-9/h1-5H
Synonyms:- 7-Bromo-2,3-dichlorodibenzo-p-dioxin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.