CymitQuimica logo

CAS 97744-98-4

:

1H-Pyrrole-3-carboximidamide

Description:
1H-Pyrrole-3-carboximidamide, with the CAS number 97744-98-4, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing one nitrogen atom. This compound features a carboximidamide functional group, which contributes to its reactivity and potential applications in various chemical reactions. Typically, pyrrole derivatives exhibit interesting biological activities, making them of interest in medicinal chemistry. The presence of the carboximidamide group may enhance its ability to form hydrogen bonds, influencing its solubility and interaction with biological targets. Additionally, 1H-Pyrrole-3-carboximidamide may participate in various synthetic pathways, including coupling reactions and as a building block for more complex molecules. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the compound. Overall, this substance represents a valuable entity in the field of organic chemistry and drug development, warranting further exploration of its properties and potential applications.
Formula:C5H7N3
InChI:InChI=1S/C5H7N3/c6-5(7)4-1-2-8-3-4/h1-3,8H,(H3,6,7)
InChI key:InChIKey=XVEVWOAHSYZRQE-UHFFFAOYSA-N
SMILES:C(=N)(N)C=1C=CNC1
Synonyms:
  • Hopamidine
  • Brunfelsamidine
  • 1H-Pyrrole-3-carboximidamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.