CAS 97776-05-1
:4-amino-3-bromo-5-(trifluoromethyl)benzoic acid
Description:
4-Amino-3-bromo-5-(trifluoromethyl)benzoic acid is an aromatic compound characterized by the presence of an amino group (-NH2), a bromine atom (Br), and a trifluoromethyl group (-CF3) attached to a benzoic acid structure. This compound features a carboxylic acid functional group (-COOH), which contributes to its acidic properties. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and biological activity. The bromine substituent can also affect the compound's electronic properties and steric hindrance, potentially impacting its interactions in chemical reactions. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure allows for various applications, including in the synthesis of more complex molecules or as a potential intermediate in pharmaceutical development. As with many halogenated compounds, it is essential to handle it with care due to potential environmental and health impacts.
Formula:C8H5BrF3NO2
InChI:InChI=1/C8H5BrF3NO2/c9-5-2-3(7(14)15)1-4(6(5)13)8(10,11)12/h1-2H,13H2,(H,14,15)
SMILES:c1c(cc(c(c1C(F)(F)F)N)Br)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.