CymitQuimica logo

CAS 97780-97-7

:

4-(2-methylprop-2-enyl)benzonitrile

Description:
4-(2-Methylprop-2-enyl)benzonitrile, also known by its CAS number 97780-97-7, is an organic compound characterized by the presence of a benzonitrile moiety substituted with a 2-methylprop-2-enyl group at the para position. This compound features a nitrile functional group (-C≡N), which contributes to its reactivity and potential applications in organic synthesis. The presence of the alkenyl substituent introduces unsaturation, which can participate in various chemical reactions, such as polymerization or addition reactions. The compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. Its molecular structure suggests it may exhibit interesting properties, such as moderate polarity and potential for hydrogen bonding due to the nitrile group. Additionally, its unique structure may impart specific biological or chemical activity, making it of interest in fields such as medicinal chemistry or materials science. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H11N
InChI:InChI=1/C11H11N/c1-9(2)7-10-3-5-11(8-12)6-4-10/h3-6H,1,7H2,2H3
SMILES:C=C(C)Cc1ccc(cc1)C#N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.