CAS 97782-08-6

(1S)-1-(7-amino-5-fluoro-2H-pyrazolo[4,3-d]pyrimidin-3-yl)-1,4-anhydro-D-ribitol

Description:

The chemical substance known as (1S)-1-(7-amino-5-fluoro-2H-pyrazolo[4,3-d]pyrimidin-3-yl)-1,4-anhydro-D-ribitol, with the CAS number 97782-08-6, is a complex organic compound characterized by its unique structural features. It contains a pyrazolo[4,3-d]pyrimidine moiety, which contributes to its biological activity, particularly in the context of nucleoside analogs. The presence of an amino group and a fluorine atom enhances its potential for interaction with biological targets, making it of interest in medicinal chemistry. The 1,4-anhydro-D-ribitol component suggests that it may mimic natural nucleosides, potentially influencing nucleic acid metabolism. This compound is likely to exhibit specific solubility and stability characteristics, influenced by its functional groups and overall molecular structure. Its stereochemistry, indicated by the (1S) designation, may also play a critical role in its biological activity and pharmacokinetics. Overall, this substance is significant in research related to antiviral or anticancer therapies, where nucleoside analogs are often explored for their therapeutic potential.

Formula: C₁₀H₁₂FN₅O₄

InChI: InChI=1/C10H12FN5O4/c11-10-13-3-4(15-16-5(3)9(12)14-10)8-7(19)6(18)2(1-17)20-8/h2,6-8,17-19H,1H2,(H,15,16)(H2,12,13,14)/t2-,6-,7-,8+/m1/s1