CAS 97817-23-7

4,5,6,7-tetrahydro[1,3]thiazolo[5,4-c]pyridin-2-amine

Description:

4,5,6,7-tetrahydro[1,3]thiazolo[5,4-c]pyridin-2-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both thiazole and pyridine moieties. This compound features a saturated tetrahydro framework, contributing to its stability and potential biological activity. The presence of an amine group enhances its reactivity and solubility in polar solvents, making it a candidate for various chemical reactions and applications. Typically, compounds of this nature may exhibit pharmacological properties, including antimicrobial or antitumor activities, due to their ability to interact with biological targets. The thiazole and pyridine rings can participate in π-π stacking and hydrogen bonding, influencing their interactions in biological systems. Additionally, the compound's molecular structure suggests potential for modification, allowing for the synthesis of derivatives with tailored properties. As with many heterocycles, understanding its reactivity and biological implications requires further investigation through experimental studies and computational modeling.

Formula: C₆H₉N₃S

InChI: InChI=1/C6H9N3S/c7-6-9-4-1-2-8-3-5(4)10-6/h8H,1-3H2,(H2,7,9)

SMILES: C1CNCc2c1[nH]c(=N)s2

Synonyms:

• Thiazolo[5,4-c]pyridin-2-amine, 4,5,6,7-tetrahydro-

Thiazolo[5,4-c]pyridin-2-amine, 4,5,6,7-tetrahydro-

CAS: 97817-23-7

Formula: C₆H₉N₃S

Purity: 97%

Color and Shape: Solid

Molecular weight: 155.2208

Ref: IN-DA00IJZK

4,5,6,7-Tetrahydrothiazolo[5,4-c]pyridin-2-ylamine

CAS: 97817-23-7

Formula: C₆H₉N₃S

Purity: 95%

Molecular weight: 155.22

Ref: 10-F221559