
CAS 97818-84-3
:1-(2-Chloroethoxy)-4-[(1E)-1,2-diphenyl-1-buten-1-yl]benzene
Description:
1-(2-Chloroethoxy)-4-[(1E)-1,2-diphenyl-1-buten-1-yl]benzene, with the CAS number 97818-84-3, is an organic compound characterized by its complex structure, which includes a benzene ring substituted with both a chloroethoxy group and a diphenylbutenyl moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for electrophilic substitution reactions. The presence of the chloroethoxy group introduces polar characteristics, which can influence solubility in various solvents, while the diphenylbutenyl component may contribute to its reactivity and potential applications in organic synthesis or as a pharmaceutical intermediate. The compound's molecular structure suggests it may have interesting electronic properties, making it a candidate for studies in materials science or medicinal chemistry. Additionally, its synthesis and reactivity can be influenced by the presence of functional groups, which may affect its behavior in biological systems or industrial applications. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C24H23ClO
InChI:InChI=1S/C24H23ClO/c1-2-23(19-9-5-3-6-10-19)24(20-11-7-4-8-12-20)21-13-15-22(16-14-21)26-18-17-25/h3-16H,2,17-18H2,1H3/b24-23+
InChI key:InChIKey=GWAJMDNEUFHRBV-WCWDXBQESA-N
SMILES:C(=C(\CC)/C1=CC=CC=C1)(\C2=CC=C(OCCCl)C=C2)/C3=CC=CC=C3
Synonyms:- 1-(2-Chloroethoxy)-4-[(1E)-1,2-diphenyl-1-buten-1-yl]benzene
- Benzene, 1-(2-chloroethoxy)-4-[(1E)-1,2-diphenyl-1-buten-1-yl]-
- Benzene, 1-(2-chloroethoxy)-4-(1,2-diphenyl-1-butenyl)-, (E)-
- Benzene, 1-(2-chloroethoxy)-4-[(1E)-1,2-diphenyl-1-butenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
