CAS 97818-93-4: {4-[(1Z)-1,2-diphenylbut-1-en-1-yl]phenoxy}acetic acid
Description:{4-[(1Z)-1,2-diphenylbut-1-en-1-yl]phenoxy}acetic acid, with the CAS number 97818-93-4, is an organic compound characterized by its phenoxyacetic acid structure, which features a phenyl group substituted with a diphenylbutene moiety. This compound typically exhibits properties associated with both phenolic and carboxylic acid functionalities, including potential acidity due to the carboxylic acid group and hydrophobic characteristics from the aromatic rings. It may demonstrate biological activity, particularly in plant growth regulation or herbicidal applications, owing to its structural similarity to auxins, which are plant hormones. The presence of multiple aromatic rings suggests that it may have significant stability and lipophilicity, influencing its solubility and interaction with biological systems. Additionally, the geometric configuration indicated by the (1Z) notation suggests specific stereochemical properties that could affect its reactivity and biological interactions. Overall, this compound's unique structure positions it as a potentially valuable substance in agricultural chemistry and related fields.
Formula:C24H22O3
InChI:InChI=1/C24H22O3/c1-2-22(18-9-5-3-6-10-18)24(19-11-7-4-8-12-19)20-13-15-21(16-14-20)27-17-23(25)26/h3-16H,2,17H2,1H3,(H,25,26)/b24-22-
- Synonyms:
- acetic acid, 2-[4-[(1Z)-1,2-diphenyl-1-buten-1-yl]phenoxy]-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Z-[4-(1,2-Diphenyl-1-butenyl)phenoxy]acetic Acid REF: TR-D489468CAS: 97818-93-4 | - - - | 457.00 €~3,096.00 € | Mon 16 Jun 25 |

Z-[4-(1,2-Diphenyl-1-butenyl)phenoxy]acetic Acid
Controlled ProductRef: TR-D489468
50mg | 457.00 € | ||
250mg | 1,629.00 € | ||
500mg | 3,096.00 € |