CAS 97856-19-4
:(3S,5R)-5-(1-formylethenyl)-3-hydroxy-2-methylcyclopent-1-ene-1-carbaldehyde
Description:
The chemical substance known as (3S,5R)-5-(1-formylethenyl)-3-hydroxy-2-methylcyclopent-1-ene-1-carbaldehyde, with the CAS number 97856-19-4, is characterized by its unique structural features that include a cyclopentene ring, a hydroxyl group, and an aldehyde functional group. This compound exhibits chirality, indicated by its specific stereochemical configuration at the 3 and 5 positions, which can influence its reactivity and interactions in biological systems. The presence of the formylethenyl group suggests potential reactivity in addition reactions, while the hydroxyl group may participate in hydrogen bonding, affecting its solubility and boiling point. As an aldehyde, it is likely to undergo typical reactions associated with carbonyl compounds, such as oxidation and condensation. The compound's specific stereochemistry and functional groups may also impart distinct properties, making it of interest in synthetic organic chemistry and potentially in the development of pharmaceuticals or agrochemicals. Overall, its structural complexity and functional diversity contribute to its potential applications in various chemical contexts.
Formula:C10H12O3
InChI:InChI=1/C10H12O3/c1-6(4-11)8-3-10(13)7(2)9(8)5-12/h4-5,8,10,13H,1,3H2,2H3/t8-,10+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(1R-trans)-2-Formyl-4-hydroxy-3-methyl-α-methylene-2-cyclopentene-1-acetaldehyde
CAS:Formula:C10H12O3Molecular weight:180.20058,9-Didehydro-7-hydroxydolichodial
CAS:8,9-Didehydro-7-hydroxydolichodial is a natural product of Patrinia, Valerianaceae.Formula:C10H12O3Purity:98%Color and Shape:SolidMolecular weight:180.28,9-Didehydro-7-hydroxydolichodial
CAS:8,9-Didehydro-7-hydroxydolichodial is a specialized natural compound known as a sesquiterpene dialdehyde. It is derived from a specific plant source, typically those found in exotic floral species that produce a range of complex secondary metabolites. The compound is characterized by its distinct molecular structure featuring conjugated double bonds and hydroxyl groups.Formula:C10H12O3Purity:Min. 95%Molecular weight:180.2 g/mol



