CAS 97867-30-6

1-Propanesulfonic acid, 3-chloro-2-hydroxy-, sodium salt (1:1)

Description:

1-Propanesulfonic acid, 3-chloro-2-hydroxy-, sodium salt (1:1), with CAS number 97867-30-6, is an organic compound characterized by its sulfonic acid functional group, which imparts strong acidity and solubility in water. This compound features a chlorine atom and a hydroxyl group attached to a propane backbone, contributing to its reactivity and potential applications in various chemical processes. As a sodium salt, it is typically more stable and soluble in aqueous solutions compared to its acid form. The presence of the sulfonate group enhances its ability to act as a surfactant, making it useful in formulations for detergents, emulsifiers, and dispersants. Additionally, the compound may exhibit biological activity, which could be relevant in pharmaceutical or agricultural contexts. Its properties, such as pH stability and compatibility with other substances, make it valuable in industrial applications, particularly in the synthesis of other chemical compounds or as an additive in various formulations.

Formula: C₃H₇ClO₄S·Na

InChI: InChI=1S/C3H7ClO4S.Na/c4-1-3(5)2-9(6,7)8;/h3,5H,1-2H2,(H,6,7,8);

InChI key: InChIKey=NWISHBWZLSLOBC-UHFFFAOYSA-N

SMILES: C(S(=O)(=O)O)C(CCl)O.[Na]

Synonyms:

• Sodium 1-chloro-2-hydroxypropane-3-sulfonate
• 1-Propanesulfonic acid, 3-chloro-2-hydroxy-, monosodium salt
• Sodium 2-hydroxy-3-chloropropanesulfonate
• Sodium 3-chloro-2-hydroxypropanesulfonate
• 1-Propanesulfonic acid, 3-chloro-2-hydroxy-, sodium salt (1:1)