CAS 97888-80-7
:4-Benzyloxy-3,5-dimethylbenzoic acid
Description:
4-Benzyloxy-3,5-dimethylbenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a benzyloxy group and two methyl groups. The presence of the benzyloxy group enhances its lipophilicity, potentially influencing its solubility and reactivity. The methyl groups at the 3 and 5 positions of the benzene ring contribute to steric hindrance, which can affect the compound's reactivity and interaction with other molecules. This compound may exhibit properties typical of benzoic acids, such as acidity, and can participate in various chemical reactions, including esterification and nucleophilic substitution. Its structural features suggest potential applications in organic synthesis, pharmaceuticals, or as a building block in the development of more complex molecules. Additionally, the compound's unique characteristics may allow for specific interactions in biological systems, making it of interest in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C16H16O3
InChI:InChI=1S/C16H16O3/c1-11-8-14(16(17)18)9-12(2)15(11)19-10-13-6-4-3-5-7-13/h3-9H,10H2,1-2H3,(H,17,18)
InChI key:InChIKey=JABUPJCJZZNUFK-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C(C)C=C(C(O)=O)C=C2C
Synonyms:- 3,5-Dimethyl-4-(phenylmethoxy)benzoic acid
- 4-(Benzyloxy)-3,5-Dimethylbenzoate
- Benzoic Acid, 3,5-Dimethyl-4-(Phenylmethoxy)-
- 4-Benzyloxy-3,5-dimethylbenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Benzyloxy-3,5-dimethylbenzoic acid, 98+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C16H15O3Purity:98+%Color and Shape:Crystals or powder or crystalline powder, Pale yellow to yellow to creamMolecular weight:255.294-Benzyloxy-3,5-dimethylbenzoic acid
CAS:Formula:C16H16O3Purity:98%Color and Shape:SolidMolecular weight:256.29644-Benzyloxy-3,5-dimethylbenzoic acid
CAS:4-Benzyloxy-3,5-dimethylbenzoic acidPurity:98%Molecular weight:256.3g/mol4-Benzyloxy-3,5-dimethylbenzoic acid
CAS:4-Benzyloxy-3,5-dimethylbenzoic acid is an organic compound with the chemical formula CHCOCH. It is a benzyl derivative of isoindoline. The benzyl group can be removed by debenzylation to form isoindolines.Formula:C16H16O3Purity:Min. 95%Molecular weight:256.3 g/mol




