
CAS 97889-13-9
:2-Propenoic acid, 2-methyl-, 2,3,4,5,6-pentabromophenyl ester, homopolymer
Description:
2-Propenoic acid, 2-methyl-, 2,3,4,5,6-pentabromophenyl ester, homopolymer, commonly referred to as a brominated acrylic polymer, is characterized by its high bromine content, which imparts flame-retardant properties. This polymer is derived from the polymerization of a brominated monomer, resulting in a structure that enhances thermal stability and reduces flammability. The presence of the pentabromophenyl group contributes to its effectiveness as a flame retardant, making it suitable for applications in various industries, including electronics and textiles. Additionally, this polymer exhibits good chemical resistance and mechanical strength, which are essential for maintaining performance in demanding environments. Its solubility and compatibility with other materials can vary, depending on the specific formulation and processing conditions. Safety considerations are important when handling this substance, as brominated compounds can pose environmental and health risks. Overall, this polymer is valued for its unique combination of properties, particularly in applications requiring enhanced fire safety.
Formula:(C10H5Br5O2)x
InChI:InChI=1S/C10H5Br5O2/c1-3(2)10(16)17-9-7(14)5(12)4(11)6(13)8(9)15/h1H2,2H3
InChI key:InChIKey=OFZRSOGEOFHZKS-UHFFFAOYSA-N
SMILES:O(C(C(C)=C)=O)C1=C(Br)C(Br)=C(Br)C(Br)=C1Br
Synonyms:- Poly(pentabromophenyl methacrylate)
- Pentabromophenyl methacrylate homopolymer
- 2-Propenoic acid, 2-methyl-, 2,3,4,5,6-pentabromophenyl ester, homopolymer
- 2-Propenoic acid, 2-methyl-, pentabromophenyl ester, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Propenoic acid, 2-methyl-, 2,3,4,5,6-pentabromophenyl ester, homopolymer
CAS:Formula:C10H5Br5O2Molecular weight:556.6655
