CymitQuimica logo

CAS 97892-65-4

:

2-hydrazinyl-7-methoxy-4-methylquinoline

Description:
2-Hydrazinyl-7-methoxy-4-methylquinoline is a chemical compound characterized by its unique structure, which includes a quinoline core substituted with a hydrazine group and methoxy and methyl functional groups. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, including antimicrobial or antitumor effects, due to the presence of the hydrazine moiety. The methoxy group can influence the compound's solubility and reactivity, while the methyl group may affect its steric properties. In terms of physical characteristics, compounds of this nature often have moderate to high melting points and may be soluble in organic solvents. The presence of nitrogen in the hydrazine group can also impart basicity, affecting its interaction with acids and bases. Overall, 2-hydrazinyl-7-methoxy-4-methylquinoline is of interest in medicinal chemistry and may serve as a lead compound for further pharmacological studies. However, specific data regarding its toxicity, stability, and detailed reactivity would require further investigation and empirical analysis.
Formula:C11H13N3O
InChI:InChI=1/C11H13N3O/c1-7-5-11(14-12)13-10-6-8(15-2)3-4-9(7)10/h3-6H,12H2,1-2H3,(H,13,14)
SMILES:Cc1cc(nc2cc(ccc12)OC)NN
Synonyms:
  • 2-Hydrazino-7-methoxy-4-methylquinoline
  • Quinoline, 2-Hydrazinyl-7-Methoxy-4-Methyl-
Found 1 products.