CymitQuimica logo

CAS 97892-86-9

:

Quillaic acid 3-O-{β-D-xylopyranosyl-(1→3)-[β-D-galactopyranosyl-(1→2)]-β-D-glucopyranosiduronic acid}

Description:
Quillaic acid 3-O-{β-D-xylopyranosyl-(1→3)-[β-D-galactopyranosyl-(1→2)]-β-D-glucopyranosiduronic acid} is a complex glycoside derived from the bark of the Quillaja saponaria tree, commonly known as the soapbark tree. This compound is characterized by its intricate structure, which includes multiple sugar moieties linked through specific glycosidic bonds. The presence of a uronic acid component contributes to its solubility and potential biological activity. Quillaic acid is known for its surfactant properties, making it useful in various applications, including pharmaceuticals and cosmetics. It exhibits immunomodulatory effects and has been studied for its potential in vaccine adjuvants. The compound's unique structural features, including the specific arrangement of sugar units, play a crucial role in its biological interactions and efficacy. Overall, quillaic acid and its derivatives are of significant interest in both natural product chemistry and applied sciences due to their diverse functional properties.
Formula:C47H72O20
InChI:InChI=1S/C47H72O20/c1-42(2)13-14-47(41(60)61)21(15-42)20-7-8-25-43(3)11-10-27(44(4,19-49)24(43)9-12-45(25,5)46(20,6)16-26(47)51)64-40-36(67-39-32(56)30(54)29(53)23(17-48)63-39)34(33(57)35(66-40)37(58)59)65-38-31(55)28(52)22(50)18-62-38/h7,19,21-36,38-40,48,50-57H,8-18H2,1-6H3,(H,58,59)(H,60,61)/t21-,22+,23+,24+,25+,26+,27-,28-,29-,30-,31+,32+,33-,34-,35-,36+,38-,39-,40+,43-,44-,45+,46+,47+/m0/s1
InChI key:InChIKey=KUOJCJXXMJCHIN-OOIFEJPQSA-N
SMILES:C(O)(=O)[C@]12[C@](C=3[C@@](C)(C[C@H]1O)[C@@]4(C)[C@](CC3)([C@]5(C)[C@@](CC4)([C@@](C=O)(C)[C@@H](O[C@H]6[C@H](O[C@@H]7O[C@H](CO)[C@H](O)[C@H](O)[C@H]7O)[C@@H](O[C@H]8[C@H](O)[C@@H](O)[C@H](O)CO8)[C@H](O)[C@@H](C(O)=O)O6)CC5)[H])[H])(CC(C)(C)CC2)[H]
Synonyms:
  • QH 957
  • QS L1
  • (3β,4α,16α)-17-Carboxy-16-hydroxy-23-oxo-28-norolean-12-en-3-yl O-β-D-galactopyranosyl-(1→2)-O-[β-D-xylopyranosyl-(1→3)]-β-D-glucopyranosiduronic acid
  • 28-Noroleanane, β-D-glucopyranosiduronic acid deriv.
  • β-D-Glucopyranosiduronic acid, (3β,4α,16α)-17-carboxy-16-hydroxy-23-oxo-28-norolean-12-en-3-yl O-β-D-galactopyranosyl-(1→2)-O-[β-D-xylopyranosyl-(1→3)]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.