CAS 97902-67-5

6-Bromo-1,2,3,4-tetrahydro-2-naphthalenemethanol

Description:

6-Bromo-1,2,3,4-tetrahydro-2-naphthalenemethanol is an organic compound characterized by its complex bicyclic structure, which includes a bromine substituent and a hydroxymethyl group. This compound belongs to the class of naphthalene derivatives and features a tetrahydro configuration, indicating that it has undergone partial hydrogenation. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The hydroxymethyl group contributes to its solubility in polar solvents and can participate in hydrogen bonding, influencing its physical properties such as boiling and melting points. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Its CAS number, 97902-67-5, allows for easy identification and retrieval of information regarding its properties, safety data, and potential applications in research and industry. Overall, 6-Bromo-1,2,3,4-tetrahydro-2-naphthalenemethanol is a versatile compound with implications in synthetic organic chemistry and pharmacology.

Formula: C₁₁H₁₃BrO

InChI: InChI=1S/C11H13BrO/c12-11-4-3-9-5-8(7-13)1-2-10(9)6-11/h3-4,6,8,13H,1-2,5,7H2

InChI key: InChIKey=OLJFIANZQGHKGE-UHFFFAOYSA-N

SMILES: C(O)C1CC=2C(=CC(Br)=CC2)CC1

Synonyms:

• (6-Bromo-1,2,3,4-tetrahydronaphthalen-2-yl)methanol
• 2-Naphthalenemethanol, 6-bromo-1,2,3,4-tetrahydro-
• 6-Bromo-1,2,3,4-tetrahydro-2-naphthalenemethanol