CAS 97908-43-5

L-γ-Glutamyl-S-[2-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)ethyl]-L-cysteinylglycine

Description:

L-γ-Glutamyl-S-[2-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)ethyl]-L-cysteinylglycine, with the CAS number 97908-43-5, is a synthetic peptide that features a unique combination of amino acids and a pyrrole-derived moiety. This compound is characterized by its structural complexity, which includes a γ-glutamyl group linked to a cysteinylglycine unit, and a substituent that incorporates a pyrrole ring, contributing to its potential biological activity. The presence of the pyrrole structure may impart specific reactivity and interactions with biological targets, making it of interest in medicinal chemistry and drug design. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, its potential applications may include roles in biochemical pathways or as a therapeutic agent, although specific biological activities would require further investigation. Overall, this compound exemplifies the intricate nature of peptide derivatives and their potential utility in various scientific fields.

Formula: C₁₆H₂₂N₄O₈S

InChI: InChI=1S/C16H22N4O8S/c17-9(16(27)28)1-2-11(21)19-10(15(26)18-7-14(24)25)8-29-6-5-20-12(22)3-4-13(20)23/h3-4,9-10H,1-2,5-8,17H2,(H,18,26)(H,19,21)(H,24,25)(H,27,28)/t9-,10-/m0/s1

InChI key: InChIKey=VQDKPBCISILESC-UWVGGRQHSA-N

SMILES: C(CSC[C@H](NC(CC[C@@H](C(O)=O)N)=O)C(NCC(O)=O)=O)N1C(=O)C=CC1=O

Synonyms:

• Glycine, N-[S-[2-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)ethyl]-N-L-γ-glutamyl-L-cysteinyl]-
• L-γ-Glutamyl-S-[2-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)ethyl]-L-cysteinylglycine
• Glycine, L-γ-glutamyl-S-[2-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)ethyl]-L-cysteinyl-

Glutathione Impurity 6

CAS: 97908-43-5

Formula: C₁₆H₂₂N₄O₈S

Molecular weight: 430.43

Ref: 4Z-PG-2524