CAS 97914-59-5

2-(Difluoromethoxy)benzoic acid

Description:

2-(Difluoromethoxy)benzoic acid is an aromatic carboxylic acid characterized by the presence of a benzoic acid moiety substituted with a difluoromethoxy group at the ortho position. This compound features a benzene ring, which contributes to its stability and potential for various chemical reactions. The difluoromethoxy group introduces electronegative fluorine atoms, enhancing the compound's polarity and potentially affecting its solubility in polar solvents. The carboxylic acid functional group (-COOH) imparts acidic properties, allowing the compound to participate in acid-base reactions. Additionally, the presence of fluorine atoms can influence the compound's reactivity, biological activity, and interaction with other molecules. 2-(Difluoromethoxy)benzoic acid may be of interest in pharmaceutical research and development due to its unique structural features, which could lead to specific biological activities or applications in medicinal chemistry. Overall, this compound exemplifies the interplay between functional groups and molecular structure in determining chemical behavior and potential applications.

Formula: C₈H₆F₂O₃

InChI: InChI=1/C8H6F2O3/c9-8(10)13-6-4-2-1-3-5(6)7(11)12/h1-4,8H,(H,11,12)

SMILES: c1ccc(c(c1)C(=O)O)OC(F)F

Synonyms:

• 2-(Difluorometoxy)benzoic acid
• 2-(Difluoromethoxy)Benzoate

2-(Difluoromethoxy)benzoic acid

CAS: 97914-59-5

Formula: C₈H₆F₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 188.1282

Ref: IN-DA003B2I

2-(Difluoromethoxy)benzoic acid

CAS: 97914-59-5

2-(Difluoromethoxy)benzoic acid

Formula: C₈H₆F₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 188.13g/mol

Ref: 54-PC3432

2-(Difluoromethoxy)benzoic acid

CAS: 97914-59-5

Formula: C₈H₆F₂O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 188.13

Ref: 10-F007852