CAS 97915-46-3
:2,7,8,9-Tetrahydro-6-methyl-9-methylene-2-oxoazuleno[4,5-b]furan-3-carboxaldehyde
Description:
2,7,8,9-Tetrahydro-6-methyl-9-methylene-2-oxoazuleno[4,5-b]furan-3-carboxaldehyde, with the CAS number 97915-46-3, is a complex organic compound characterized by its unique fused ring structure that incorporates both furan and azulene moieties. This compound features multiple functional groups, including a carboxaldehyde and a ketone, which contribute to its reactivity and potential applications in organic synthesis. The presence of the methyl and methylene groups enhances its structural diversity and may influence its physical properties, such as solubility and boiling point. Additionally, the compound's stereochemistry can affect its biological activity and interactions with other molecules. While specific data on its toxicity and environmental impact may not be widely available, compounds of this nature often require careful handling due to potential reactivity. Overall, 2,7,8,9-Tetrahydro-6-methyl-9-methylene-2-oxoazuleno[4,5-b]furan-3-carboxaldehyde represents a fascinating subject for further research in fields such as medicinal chemistry and materials science.
Formula:C15H12O3
InChI:InChI=1S/C15H12O3/c1-8-3-6-11-12(7-16)15(17)18-14(11)13-9(2)4-5-10(8)13/h3,6-7H,2,4-5H2,1H3
InChI key:InChIKey=PATCUDSVUMFCMB-UHFFFAOYSA-N
SMILES:C=C1C2=C3C(=C(C=O)C(=O)O3)C=CC(C)=C2CC1
Synonyms:- Azuleno[4,5-b]furan-3-carboxaldehyde, 2,7,8,9-tetrahydro-6-methyl-9-methylene-2-oxo-
- Lettucenin A
- 2,7,8,9-Tetrahydro-6-methyl-9-methylene-2-oxoazuleno[4,5-b]furan-3-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lettucenin A
CAS:Lettucenin A is a sesquiterpenoid lactone phytoalexin.Formula:C15H12O3Color and Shape:SolidMolecular weight:240.25
