
CAS 97917-08-3
:Poly(o-toluidine)
Description:
Poly(o-toluidine) is a conducting polymer derived from the polymerization of o-toluidine, an aromatic amine. This substance exhibits unique electrical conductivity properties, making it valuable in various applications, including sensors, actuators, and electronic devices. Poly(o-toluidine) is characterized by its ability to undergo doping, which enhances its conductivity, and it can exist in different oxidation states, leading to variations in color and electrical properties. The polymer typically appears as a dark green or black solid, depending on its oxidation state. It is soluble in organic solvents, which facilitates processing and application in composite materials. Additionally, poly(o-toluidine) demonstrates good thermal stability and mechanical properties, making it suitable for use in various environments. Its synthesis can be achieved through chemical or electrochemical polymerization methods, allowing for control over molecular weight and morphology. Overall, poly(o-toluidine) is a versatile material with significant potential in advanced technological applications.
Formula:(C7H9N)x
InChI:InChI=1S/C7H9N/c1-6-4-2-3-5-7(6)8/h2-5H,8H2,1H3
InChI key:InChIKey=RNVCVTLRINQCPJ-UHFFFAOYSA-N
SMILES:CC1=C(N)C=CC=C1
Synonyms:- o-Toluidine homopolymer
- Poly(o-toluidine)
- o-Toluidine polymer
- Benzenamine, 2-methyl-, homopolymer
- Poly(2-Methylaniline)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
