CAS 97958-08-2
:N~5~-(diaminomethylidene)-L-ornithine - 3,7-dimethoxy-4-phenyl-N-(2H-tetrazol-5-yl)-4H-furo[3,2-b]indole-2-carboxamide (1:1)
Description:
N~5~-(diaminomethylidene)-L-ornithine - 3,7-dimethoxy-4-phenyl-N-(2H-tetrazol-5-yl)-4H-furo[3,2-b]indole-2-carboxamide, with CAS number 97958-08-2, is a complex organic compound characterized by its unique structural features, including a furoindole framework and multiple functional groups. This compound contains an ornithine derivative, which is an amino acid involved in various biological processes, particularly in the urea cycle. The presence of a tetrazole ring contributes to its potential biological activity, as tetrazoles are known for their pharmacological properties. The dimethoxy and phenyl substituents enhance its lipophilicity and may influence its interaction with biological targets. This compound's intricate structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutics. However, detailed studies on its pharmacodynamics, toxicity, and specific biological activities would be necessary to fully understand its potential uses and implications in research and medicine.
Formula:C26H30N10O6
InChI:InChI=1/C20H16N6O4.C6H14N4O2/c1-28-12-8-9-14-13(10-12)16-15(26(14)11-6-4-3-5-7-11)17(29-2)18(30-16)19(27)21-20-22-24-25-23-20;7-4(5(11)12)2-1-3-10-6(8)9/h3-10H,1-2H3,(H2,21,22,23,24,25,27);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t;4-/m.0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
CI 922
CAS:CI 922 is an anaphylaxis mediator release inhibitor. It inhibits the activation of human neutrophils.Formula:C26H30N10O6Color and Shape:SolidMolecular weight:578.58
