CAS 97968-85-9

2-(2-cyclopropylbenzimidazol-1-yl)acetic acid

Description:

2-(2-Cyclopropylbenzimidazol-1-yl)acetic acid, with the CAS number 97968-85-9, is a chemical compound that features a benzimidazole moiety substituted with a cyclopropyl group and an acetic acid functional group. This compound is characterized by its unique bicyclic structure, which contributes to its potential biological activity. The presence of the benzimidazole ring often indicates possible pharmacological properties, as many benzimidazole derivatives are known for their roles as pharmaceuticals. The cyclopropyl group can influence the compound's steric and electronic properties, potentially enhancing its interaction with biological targets. Additionally, the acetic acid functional group may impart acidic characteristics, affecting solubility and reactivity. Overall, this compound's structural features suggest it may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific biological activities and applications would require further investigation through experimental studies.

Formula: C₁₂H₁₂N₂O₂

InChI: InChI=1/C12H12N2O2/c15-11(16)7-14-10-4-2-1-3-9(10)13-12(14)8-5-6-8/h1-4,8H,5-7H2,(H,15,16)

SMILES: c1ccc2c(c1)nc(C1CC1)n2CC(=O)O