CAS 97989-54-3

(4-Chloro-1-methyl-1H-pyrrolo[3,2-c]pyridin-3-yl)methanol

Description:

(4-Chloro-1-methyl-1H-pyrrolo[3,2-c]pyridin-3-yl)methanol, with the CAS number 97989-54-3, is a chemical compound characterized by its unique pyrrolopyridine structure, which incorporates a chlorine atom and a hydroxymethyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its nitrogen-containing ring system. The presence of the chlorine substituent may influence its reactivity and solubility, while the hydroxymethyl group can participate in hydrogen bonding, affecting its interactions in biological systems. Such compounds are often studied for their pharmacological properties, including potential applications in medicinal chemistry. The molecular structure suggests that it may engage in various chemical reactions, including nucleophilic substitutions and potential interactions with biological targets. Overall, this compound's characteristics make it of interest in both synthetic chemistry and drug discovery contexts.

Formula: C₉H₉ClN₂O

InChI: InChI=1/C9H9ClN2O/c1-12-4-6(5-13)8-7(12)2-3-11-9(8)10/h2-4,13H,5H2,1H3

SMILES: Cn1cc(CO)c2c1ccnc2Cl

1H-Pyrrolo[3,2-c]pyridine-3-methanol, 4-chloro-1-methyl-

CAS: 97989-54-3

Formula: C₉H₉ClN₂O

Purity: 97%

Molecular weight: 196.6336

Ref: IN-DA00IK02

(4-Chloro-1-methyl-1H-pyrrolo[3,2-c]pyridin-3-yl)methanol

CAS: 97989-54-3

Purity: 97%

Molecular weight: 196.6300049

Ref: 10-F725829