CAS 98-22-6

2,6-dibromo-4-tert-butylphenol

Description:

2,6-Dibromo-4-tert-butylphenol is an organic compound characterized by its phenolic structure, which includes two bromine atoms and a tert-butyl group attached to the aromatic ring. This compound typically appears as a solid at room temperature and is known for its moderate solubility in organic solvents, while being less soluble in water due to the hydrophobic tert-butyl group. The presence of bromine atoms enhances its reactivity, making it useful in various chemical applications, including as an intermediate in organic synthesis and as a potential additive in polymer formulations. The tert-butyl group contributes to steric hindrance, influencing the compound's reactivity and stability. Additionally, 2,6-dibromo-4-tert-butylphenol exhibits antioxidant properties, which can be beneficial in preventing oxidative degradation in materials. Safety considerations should be taken into account when handling this compound, as it may pose environmental and health risks. Proper storage and disposal methods are essential to mitigate any potential hazards associated with its use.

Formula: C₁₀H₁₂Br₂O

InChI: InChI=1/C10H12Br2O/c1-10(2,3)6-4-7(11)9(13)8(12)5-6/h4-5,13H,1-3H3

SMILES: CC(C)(C)c1cc(c(c(c1)Br)O)Br

Synonyms:

• Phenol, 2,6-dibromo-4- (1,1-dimethylethyl)-
• Phenol, 2,6-dibromo-4-tert-butyl-

2,6-Dibromo-4-(tert-butyl)phenol

CAS: 98-22-6

Formula: C₁₀H₁₂Br₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 308.0097

Ref: IN-DA005VNT

2,6-Dibromo-4-tert-butylphenol

CAS: 98-22-6

2,6-Dibromo-4-tert-butylphenol

Formula: C₁₀H₁₂Br₂O

Purity: 95%

Color and Shape: off-white solid

Molecular weight: 308.01g/mol

Ref: 54-OR53102

2,6-Dibromo-4-(tert-butyl)phenol

CAS: 98-22-6

Formula: C₁₀H₁₂Br₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 308.013

Ref: 10-F240483