
CAS 98007-99-9
:ICI 164384
Description:
ICI 164384, also known by its CAS number 98007-99-9, is a synthetic chemical compound that belongs to the class of selective serotonin reuptake inhibitors (SSRIs). It is primarily studied for its potential use in treating various mood disorders, including depression and anxiety. The compound exhibits a mechanism of action that involves the inhibition of serotonin reuptake in the brain, thereby increasing the availability of serotonin, a neurotransmitter associated with mood regulation. ICI 164384 is characterized by its specific molecular structure, which contributes to its pharmacological properties. In terms of physical characteristics, it is typically a solid at room temperature and may have specific solubility properties in various solvents. As with many pharmaceutical compounds, safety and efficacy are critical considerations, and extensive research is conducted to evaluate its therapeutic potential and side effects. Overall, ICI 164384 represents a significant area of interest in medicinal chemistry and psychopharmacology.
Formula:C34H55NO3
InChI:InChI=1S/C34H55NO3/c1-4-5-22-35(3)32(38)15-13-11-9-7-6-8-10-12-14-25-23-26-24-27(36)16-17-28(26)29-20-21-34(2)30(33(25)29)18-19-31(34)37/h16-17,24-25,29-31,33,36-37H,4-15,18-23H2,1-3H3/t25-,29-,30+,31+,33-,34+/m1/s1
InChI key:InChIKey=BVVFOLSZMQVDKV-KXQIQQEYSA-N
SMILES:C(CCCCCCCCCC(N(CCCC)C)=O)[C@H]1[C@@]2([C@@](C=3C(C1)=CC(O)=CC3)(CC[C@@]4(C)[C@]2(CC[C@@H]4O)[H])[H])[H]
Synonyms:- Estra-1,3,5(10)-triene-7-undecanamide, N-butyl-3,17-dihydroxy-N-methyl-, (7α,17β)-
- (7α,17β)-N-Butyl-3,17-dihydroxy-N-methylestra-1,3,5(10)-triene-7-undecanamide
- ICI-M 164384
- ICI 164384
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
ICI-164384
CAS:ICI-164384 is an estrogen antagonist.Formula:C34H55NO3Color and Shape:SolidMolecular weight:525.81
