CAS 98010-38-9
:1-(2-methylpyridin-4-yl)piperazine
Description:
1-(2-Methylpyridin-4-yl)piperazine is an organic compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The compound features a 2-methylpyridine substituent at one of the piperazine's nitrogen atoms, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. This compound is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological targets. Its structure allows for hydrogen bonding and potential interactions with receptors, making it of interest in drug design. The presence of the methyl group on the pyridine ring can influence its lipophilicity and biological activity. As with many piperazine derivatives, it may exhibit psychoactive properties and has been studied for its effects on the central nervous system. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C10H15N3
InChI:InChI=1/C10H15N3/c1-9-8-10(2-3-12-9)13-6-4-11-5-7-13/h2-3,8,11H,4-7H2,1H3
SMILES:Cc1cc(ccn1)N1CCNCC1
Synonyms:- Piperazine, 1-(2-Methyl-4-Pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.