CAS 98019-66-0
:4-(Hydroxyimino)-3-oxobutanoic acid
Description:
4-(Hydroxyimino)-3-oxobutanoic acid, with the CAS number 98019-66-0, is an organic compound characterized by its functional groups, including a hydroxylamine (hydroxyimino) group and a keto group, which contribute to its reactivity and potential applications in organic synthesis. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of hydroxyl and carboxylic acid functionalities. Its structure suggests it may participate in various chemical reactions, such as condensation and oxidation, making it useful in synthetic organic chemistry. The presence of both a keto and an oxime group allows for the potential formation of various derivatives, which can be explored for biological activity or as intermediates in the synthesis of more complex molecules. Additionally, the compound may exhibit specific stereochemical properties that could influence its reactivity and interactions in biological systems. Overall, 4-(Hydroxyimino)-3-oxobutanoic acid is a versatile compound with potential applications in research and industry.
Formula:C4H5NO4
InChI:InChI=1S/C4H5NO4/c6-3(2-5-9)1-4(7)8/h2,9H,1H2,(H,7,8)
InChI key:InChIKey=SMEVIORASKVRNF-UHFFFAOYSA-N
SMILES:C(C(C=NO)=O)C(O)=O
Synonyms:- Butanoic acid, 4-(hydroxyimino)-3-oxo-
- 4-(Hydroxyimino)-3-oxobutanoic acid
- Succinaldehydic acid, 3-oxo-, 4-oxime
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
