CymitQuimica logo

CAS 98021-62-6

:

4,5-dihydrofuran-3-carboxylic acid

Description:
4,5-Dihydrofuran-3-carboxylic acid is a heterocyclic organic compound characterized by a furan ring that is partially saturated, specifically at the 4 and 5 positions, with a carboxylic acid functional group at the 3 position. This compound typically exhibits a molecular structure that contributes to its reactivity and potential applications in organic synthesis. The presence of the carboxylic acid group makes it a polar molecule, which can engage in hydrogen bonding, influencing its solubility in polar solvents. The dihydrofuran moiety provides a degree of ring strain, which can enhance its reactivity in various chemical reactions, such as cycloadditions or as a building block in the synthesis of more complex molecules. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its CAS number, 98021-62-6, allows for easy identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and materials science.
Formula:C5H6O3
InChI:InChI=1/C5H6O3/c6-5(7)4-1-2-8-3-4/h3H,1-2H2,(H,6,7)
InChI key:XKWMSKXDFJSKJO-UHFFFAOYSA-N
SMILES:C1COC=C1C(=O)O
Synonyms:
  • 3-Furancarboxylic acid, 4,5-dihydro-
Found 4 products.