CAS 98025-60-6

2-Azido-N-(methylsulfonyl)acetamide

Description:

2-Azido-N-(methylsulfonyl)acetamide is a chemical compound characterized by the presence of an azido group (-N3) and a methylsulfonyl functional group (-SO2CH3) attached to an acetamide backbone. This compound typically appears as a solid or crystalline substance and is known for its potential applications in organic synthesis and medicinal chemistry, particularly in the development of bioactive molecules. The azido group is notable for its reactivity, allowing for various click chemistry reactions, which can facilitate the formation of diverse chemical structures. The methylsulfonyl moiety contributes to the compound's solubility and stability, enhancing its utility in various chemical reactions. Additionally, the presence of both functional groups may influence the compound's biological activity, making it of interest in pharmaceutical research. Safety precautions should be observed when handling this compound due to the potential hazards associated with azides, which can be explosive under certain conditions. Overall, 2-Azido-N-(methylsulfonyl)acetamide represents a versatile building block in synthetic organic chemistry.

Formula: C₃H₆N₄O₃S

InChI: InChI=1S/C3H6N4O3S/c1-11(9,10)6-3(8)2-5-7-4/h2H2,1H3,(H,6,8)

InChI key: InChIKey=RKCNTLVJSRRQJH-UHFFFAOYSA-N

SMILES: N(C(CN=[N+]=[N-])=O)S(C)(=O)=O

Synonyms:

• 2-Azido-N-(methylsulfonyl)acetamide
• Acetamide, 2-azido-N-(methylsulfonyl)-
• 2-Azido-N-methanesulfonylacetamide