CAS 98027-27-1
:5-Bromo-2-thiophenecarboxylic acid hydrazide
Description:
5-Bromo-2-thiophenecarboxylic acid hydrazide is an organic compound characterized by the presence of a thiophene ring, a bromine substituent, and a hydrazide functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential reactivity due to the presence of the hydrazide moiety, which can participate in various chemical reactions such as condensation and acylation. The bromine atom introduces a halogen functionality that can enhance the compound's reactivity and influence its physical properties, such as solubility and boiling point. Additionally, the carboxylic acid group contributes to the compound's acidity and can engage in hydrogen bonding, affecting its interactions with other molecules. The presence of the thiophene ring may also impart unique electronic properties, making it of interest in fields such as medicinal chemistry and materials science. Overall, 5-Bromo-2-thiophenecarboxylic acid hydrazide is a versatile compound with potential applications in various chemical syntheses and research areas.
Formula:C5H5BrN2OS
InChI:InChI=1/C5H5BrN2OS/c6-4-2-1-3(10-4)5(9)8-7/h1-2H,7H2,(H,8,9)
SMILES:c1cc(Br)sc1C(=O)NN
Synonyms:- 5-Bromo-thiophene-2-carboxylic acid hydrazide
- 5-Bromothiophene-2-carbohydrazide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5-Bromothiophene-2-carboxylic acid hydrazide, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C5H5BrN2OSPurity:97%Molecular weight:221.075-Bromothiophene-2-Carbohydrazide
CAS:5-Bromothiophene-2-CarbohydrazidePurity:98%Molecular weight:221.07g/mol5-Bromo-thiophene-2-carboxylic acid hydrazide
CAS:Formula:C5H5BrN2OSPurity:98%+;RGColor and Shape:SolidMolecular weight:221.07


