CAS 98027-38-4

4-Amino-2-chloro-5-pyrimidinecarboxamide

Description:

4-Amino-2-chloro-5-pyrimidinecarboxamide is a chemical compound characterized by its pyrimidine ring structure, which includes an amino group and a chloro substituent. This compound features a carboxamide functional group, contributing to its potential as a versatile building block in organic synthesis and medicinal chemistry. The presence of the amino group suggests basic properties, while the chloro group can participate in nucleophilic substitution reactions, making it useful in various chemical transformations. The compound's molecular structure allows for hydrogen bonding, which may influence its solubility and reactivity. Typically, compounds like this are studied for their biological activity, particularly in the development of pharmaceuticals, as they may exhibit antimicrobial or antitumor properties. Additionally, the specific arrangement of functional groups can affect the compound's interaction with biological targets, making it a subject of interest in drug design and discovery. Overall, 4-Amino-2-chloro-5-pyrimidinecarboxamide exemplifies the complexity and utility of heterocyclic compounds in chemistry.

Formula: C₅H₅ClN₄O

InChI: InChI=1S/C5H5ClN4O/c6-5-9-1-2(4(8)11)3(7)10-5/h1H,(H2,8,11)(H2,7,9,10)

InChI key: InChIKey=SEQWNBBMRHGRPX-UHFFFAOYSA-N

SMILES: C(N)(=O)C=1C(N)=NC(Cl)=NC1

Synonyms:

• 4-Amino-2-chloro-5-pyrimidinecarboxamide
• 5-Pyrimidinecarboxamide, 4-amino-2-chloro-
• 5-Pyrimidinecarboxamide, 6-amino-2-chloro-

4-Amino-2-chloropyrimidine-5-carboxamide

CAS: 98027-38-4

4-Amino-2-chloropyrimidine-5-carboxamide

Purity: 97%

Molecular weight: 172.57g/mol

Ref: 54-OR1069250