CymitQuimica logo

CAS 98027-80-6

:

4-bromo-2,6-dichloropyridine

Description:
4-Bromo-2,6-dichloropyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features two chlorine atoms and one bromine atom substituted at the 2, 4, and 6 positions of the pyridine ring, contributing to its unique reactivity and properties. It is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. The presence of halogen substituents enhances its potential for various chemical reactions, making it useful in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. The compound is generally stable under standard conditions but may undergo reactions typical of halogenated compounds, such as nucleophilic substitution. Additionally, it is important to handle this substance with care due to potential toxicity and environmental impact, as is common with many halogenated organic compounds. Proper safety measures should be observed when working with or disposing of this chemical.
Formula:C5H2BrCl2N
InChI:InChI=1S/C5H2BrCl2N/c6-3-1-4(7)9-5(8)2-3/h1-2H
InChI key:GUBXTQINPBZVJP-UHFFFAOYSA-N
SMILES:C1=C(C=C(N=C1Cl)Cl)Br
Found 4 products.