CAS 98027-83-9

5-Cyano-2-furansulfonyl chloride

Description:

5-Cyano-2-furansulfonyl chloride is a chemical compound characterized by its unique structure, which includes a furan ring, a cyano group, and a sulfonyl chloride functional group. This compound is typically a solid at room temperature and is known for its reactivity, particularly due to the presence of the sulfonyl chloride group, which can participate in nucleophilic substitution reactions. The cyano group contributes to its polarity and can influence its solubility in various organic solvents. 5-Cyano-2-furansulfonyl chloride is often utilized in organic synthesis, particularly in the preparation of sulfonamide derivatives and other complex molecules. Its reactivity makes it a valuable intermediate in pharmaceutical and agrochemical research. However, it should be handled with care due to its potential hazards, including corrosiveness and toxicity. Proper safety measures, including the use of personal protective equipment and working in a well-ventilated area, are essential when working with this compound.

Formula: C₅H₂ClNO₃S

InChI: InChI=1S/C5H2ClNO3S/c6-11(8,9)5-2-1-4(3-7)10-5/h1-2H

InChI key: InChIKey=VNBDOZRYYRXFQQ-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C=1OC(C#N)=CC1

Synonyms:

• 5-Cyano-2-furansulfonyl chloride
• 2-Furansulfonyl chloride, 5-cyano-

5-Cyanofuran-2-sulfonyl chloride

CAS: 98027-83-9

Versatile small molecule scaffold

Formula: C₅H₂ClNO₃S

Purity: Min. 95%

Molecular weight: 191.59 g/mol

Ref: 3D-YDA02783