CAS 98027-95-3
:2,6-Diiodopurine
Description:
2,6-Diiodopurine is a purine derivative characterized by the presence of two iodine atoms at the 2 and 6 positions of the purine ring. This compound is notable for its structural similarity to adenine, which allows it to potentially interfere with nucleic acid metabolism. It is typically a white to off-white solid and is soluble in organic solvents. The presence of iodine atoms can impart unique properties, such as increased lipophilicity and altered biological activity compared to its non-iodinated counterparts. 2,6-Diiodopurine has been studied for its potential applications in biochemistry and molecular biology, particularly in the context of antiviral and anticancer research, as it may act as a nucleoside analog. Its molecular formula reflects the incorporation of iodine, which can influence its reactivity and interactions with biological macromolecules. As with many halogenated compounds, safety precautions should be taken when handling 2,6-Diiodopurine due to potential toxicity and environmental impact.
Formula:C5H2I2N4
InChI:InChI=1/C5H2I2N4/c6-3-2-4(9-1-8-2)11-5(7)10-3/h1H,(H,8,9,10,11)
SMILES:c1nc2c(I)nc(I)[nH]c2n1
Synonyms:- 2,6-Diiodo-9H-purine
- 9H-purine, 2,6-diiodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
