CymitQuimica logo

CAS 98038-21-2

:

Poly(2-chloroaniline)

Description:
Poly(2-chloroaniline) is a conducting polymer derived from the polymerization of 2-chloroaniline, a derivative of aniline. This substance exhibits unique electrical conductivity properties, making it valuable in various applications, including sensors, electronic devices, and anti-corrosion coatings. The polymer is characterized by its ability to undergo doping, which enhances its conductivity by introducing charge carriers. Poly(2-chloroaniline) typically displays good thermal stability and can be processed into various forms, such as films or fibers. Its solubility is influenced by the presence of the chlorine substituent, which can affect the polymer's crystallinity and, consequently, its mechanical properties. Additionally, the presence of the chlorine atom can impart specific chemical reactivity, allowing for further functionalization. The polymer's color can range from green to blue, depending on its oxidation state, which is a characteristic feature of conducting polymers. Overall, poly(2-chloroaniline) is a versatile material with significant potential in advanced material science and engineering applications.
Formula:(C6H6ClN)x
InChI:InChI=1S/C6H6ClN/c7-5-3-1-2-4-6(5)8/h1-4H,8H2
InChI key:InChIKey=AKCRQHGQIJBRMN-UHFFFAOYSA-N
SMILES:ClC1=C(N)C=CC=C1
Synonyms:
  • Poly(2-chloroaniline)
  • o-Chloroaniline polymer
  • Benzenamine, 2-chloro-, homopolymer
  • Poly(o-chloroaniline)
  • 2-Chloroaniline homopolymer
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.