CAS 98041-69-1

4-bromo-2-chlorophenyl isothiocyanate

Description:

4-Bromo-2-chlorophenyl isothiocyanate is an organic compound characterized by the presence of both bromine and chlorine substituents on a phenyl ring, along with an isothiocyanate functional group. Its molecular structure features a phenyl ring substituted at the 2-position with a chlorine atom and at the 4-position with a bromine atom, which contributes to its reactivity and potential applications in various chemical reactions. The isothiocyanate group (-N=C=S) is known for its ability to participate in nucleophilic reactions, making this compound useful in synthetic organic chemistry, particularly in the development of agrochemicals and pharmaceuticals. The presence of halogens can influence the compound's physical properties, such as solubility and boiling point, as well as its biological activity. Additionally, 4-bromo-2-chlorophenyl isothiocyanate may exhibit specific toxicological properties, necessitating careful handling and storage. As with many isothiocyanates, it may also possess antimicrobial or anticancer properties, warranting further investigation in medicinal chemistry.

Formula: C₇H₃BrClNS

InChI: InChI=1/C7H3BrClNS/c8-5-1-2-7(10-4-11)6(9)3-5/h1-3H

SMILES: c1cc(c(cc1Br)Cl)N=C=S

Synonyms:

• 4-Bromo-2-chloroisothiocyanatobenzene
• 1-Bromo-2-Chloro-4-Isothiocyanatobenzene
• 4-Bromo-2-Chloro-1-Isothiocyanatobenzene

4-Bromo-2-chloro-1-isothiocyanatobenzene

CAS: 98041-69-1

Formula: C₇H₃BrClNS

Purity: 98%

Color and Shape: Solid

Molecular weight: 248.5274

Ref: IN-DA003KWD

4-Bromo-2-chlorophenyl isothiocyanate

CAS: 98041-69-1

4-Bromo-2-chlorophenyl isothiocyanate

Purity: ≥95%

Ref: 54-OR4471

4-Bromo-2-chlorophenyl isothiocyanate

CAS: 98041-69-1

Formula: C₇H₃BrClNS

Purity: 98%

Color and Shape: Solid, Low Melting Solid

Molecular weight: 248.52

Ref: 10-F008746

4-Bromo-2-chlorophenyl isothiocyanate

CAS: 98041-69-1

4-Bromo-2-chlorophenyl isothiocyanate is a high-viscosity compound that exhibits unique properties. It has been found to interact with the cannabinoid receptor type 1 (CB1 receptor), which is involved in various physiological processes. This compound acts as an antagonist to the CB1 receptor, meaning it blocks the receptor's activity. It has been extensively studied for its potential therapeutic applications in the field of endocannabinoid research.

Formula: C₇H₃BrClNS

Purity: Min. 95%

Molecular weight: 248.53 g/mol

Ref: 3D-YDA04169