CAS 98048-99-8
:Phosphonic acid, [(1S)-1-aminopropyl]-
Description:
Phosphonic acid, [(1S)-1-aminopropyl]- (CAS 98048-99-8) is an organophosphorus compound characterized by the presence of a phosphonic acid functional group and an amino group attached to a propyl chain. This compound typically exhibits properties associated with both phosphonic acids and amines, such as being a polar molecule with potential solubility in water due to its ionic nature. The presence of the amino group allows for potential interactions with biological systems, making it of interest in various fields, including agriculture and pharmaceuticals. Phosphonic acids are known for their ability to act as herbicides or fungicides, and this specific compound may exhibit similar biological activity. Additionally, it may participate in various chemical reactions, including esterification and nucleophilic substitution, due to the reactivity of the phosphonic acid moiety. Overall, its unique structure and functional groups contribute to its potential applications in different chemical and biological contexts.
Formula:C3H10NO3P
InChI:InChI=1S/C3H10NO3P/c1-2-3(4)8(5,6)7/h3H,2,4H2,1H3,(H2,5,6,7)/t3-/m0/s1
InChI key:InChIKey=DELJNDWGTWHHFA-VKHMYHEASA-N
SMILES:[C@H](P(=O)(O)O)(CC)N
Synonyms:- (S)-(1-Aminopropyl)phosphonic acid
- (1S)-(+)-(1-Aminopropyl)phosphonic acid
- Phosphonic acid, (1-aminopropyl)-, (S)-
- Phosphonic acid, [(1S)-1-aminopropyl]-
- [(1S)-1-Aminopropyl]phosphonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
