CAS 98070-39-4
:Methyl 2-chloro-3-hydroxypropionate
Description:
Methyl 2-chloro-3-hydroxypropionate, with the CAS number 98070-39-4, is an organic compound characterized by its ester functional group and the presence of both chlorine and hydroxyl groups. This compound typically appears as a colorless to pale yellow liquid and is soluble in polar organic solvents. Its molecular structure features a methyl ester group, a chloro substituent at the second carbon, and a hydroxyl group at the third carbon of a propionate chain. The presence of the chlorine atom contributes to its reactivity, making it useful in various chemical syntheses, particularly in the production of pharmaceuticals and agrochemicals. Additionally, the hydroxyl group can participate in hydrogen bonding, influencing its physical properties such as boiling point and solubility. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper safety measures, including the use of personal protective equipment, are recommended when working with this substance.
Formula:C4H7ClO3
InChI:InChI=1/C4H7ClO3/c1-8-4(7)3(5)2-6/h3,6H,2H2,1H3
SMILES:COC(=O)C(CO)Cl
Synonyms:- Methyl 2-chloro-3-hydroxypropanoate
- Propanoic acid, 2-chloro-3-hydroxy-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
