CymitQuimica logo

CAS 98072-04-9

:

2,5,8,11,14-Pentaoxahexadecan-16-ol, 1-phenyl-, dihydrogen phosphate

Description:
2,5,8,11,14-Pentaoxahexadecan-16-ol, 1-phenyl-, dihydrogen phosphate, with CAS number 98072-04-9, is a chemical compound characterized by its complex structure that includes a long-chain polyether backbone and a phosphate group. This compound features multiple ether linkages, which contribute to its solubility in polar solvents and its potential use as a surfactant or emulsifying agent. The presence of the phenyl group enhances its hydrophobic characteristics, making it suitable for applications in formulations where both hydrophilic and hydrophobic interactions are necessary. Additionally, the dihydrogen phosphate moiety suggests potential reactivity and utility in biochemical applications, such as in drug delivery systems or as a reagent in organic synthesis. The compound's unique combination of functional groups allows for versatility in various chemical environments, making it of interest in both industrial and research settings. Its stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in its practical applications.
Formula:C17H29O9P
InChI:InChI=1S/C17H29O9P/c18-27(19,20)26-15-14-24-11-10-22-7-6-21-8-9-23-12-13-25-16-17-4-2-1-3-5-17/h1-5H,6-16H2,(H2,18,19,20)
InChI key:InChIKey=OWCBSPOKYFVTBD-UHFFFAOYSA-N
SMILES:C(OCCOCCOCCOCCOCCOP(=O)(O)O)C1=CC=CC=C1
Synonyms:
  • 2,5,8,11,14-Pentaoxahexadecan-16-ol, 1-phenyl-, dihydrogen phosphate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.